C18H27ClN2O2 — CID 68506750
tert-butyl N-[[4-chloro-3-[(cyclopropylamino)methyl]phenyl]methyl]-N-ethylcarbamate (PubChem CID 68506750) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is tert-butyl N-[[4-chloro-3-[(cyclopropylamino)methyl]phenyl]methyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[[4-chloro-3-[(cyclopropylamino)methyl]phenyl]methyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 68506750 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | tert-butyl N-[[4-chloro-3-[(cyclopropylamino)methyl]phenyl]methyl]-N-ethylcarbamate |
| SMILES | CCN(Cc1ccc(Cl)c(CNC2CC2)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27ClN2O2/c1-5-21(17(22)23-18(2,3)4)12-13-6-9-16(19)14(10-13)11-20-15-7-8-15/h6,9-10,15,20H,5,7-8,11-12H2,1-4H3 |
| InChIKey | BVKRAJBAUXQNQU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |