C24H42N2O2 — CID 143499826
tert-butyl N-butyl-N-[[3-[(cyclopropylamino)methyl]-5-ethylphenyl]methyl]carbamate;ethane (PubChem CID 143499826) has the molecular formula C24H42N2O2 and a molecular weight of 390.61 g/mol. Its IUPAC name is tert-butyl N-butyl-N-[[3-[(cyclopropylamino)methyl]-5-ethylphenyl]methyl]carbamate;ethane.
| Compound Name | tert-butyl N-butyl-N-[[3-[(cyclopropylamino)methyl]-5-ethylphenyl]methyl]carbamate;ethane |
|---|---|
| PubChem CID | 143499826 |
| Molecular Formula | C24H42N2O2 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.32 |
| IUPAC Name | tert-butyl N-butyl-N-[[3-[(cyclopropylamino)methyl]-5-ethylphenyl]methyl]carbamate;ethane |
| SMILES | CC.CCCCN(Cc1cc(CC)cc(CNC2CC2)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H36N2O2.C2H6/c1-6-8-11-24(21(25)26-22(3,4)5)16-19-13-17(7-2)12-18(14-19)15-23-20-9-10-20;1-2/h12-14,20,23H,6-11,15-16H2,1-5H3;1-2H3 |
| InChIKey | BGZOFLQXBDLXQP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |