C16H26BNO4 — CID 70646200
[4-[[butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]boronic acid (PubChem CID 70646200) has the molecular formula C16H26BNO4 and a molecular weight of 307.20 g/mol. Its IUPAC name is [4-[[butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]boronic acid.
| Compound Name | [4-[[butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 70646200 |
| Molecular Formula | C16H26BNO4 |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | [4-[[butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]boronic acid |
| SMILES | CCCCN(Cc1ccc(B(O)O)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26BNO4/c1-5-6-11-18(15(19)22-16(2,3)4)12-13-7-9-14(10-8-13)17(20)21/h7-10,20-21H,5-6,11-12H2,1-4H3 |
| InChIKey | BGQRFFLZBQZAEY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|