C23H41N3O2 — CID 66941409
tert-butyl N-[[4-(aminomethyl)phenyl]methyl]-N-[4-(dipropylamino)butyl]carbamate (PubChem CID 66941409) has the molecular formula C23H41N3O2 and a molecular weight of 391.60 g/mol. Its IUPAC name is tert-butyl N-[[4-(aminomethyl)phenyl]methyl]-N-[4-(dipropylamino)butyl]carbamate.
| Compound Name | tert-butyl N-[[4-(aminomethyl)phenyl]methyl]-N-[4-(dipropylamino)butyl]carbamate |
|---|---|
| PubChem CID | 66941409 |
| Molecular Formula | C23H41N3O2 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.32 |
| IUPAC Name | tert-butyl N-[[4-(aminomethyl)phenyl]methyl]-N-[4-(dipropylamino)butyl]carbamate |
| SMILES | CCCN(CCC)CCCCN(Cc1ccc(CN)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H41N3O2/c1-6-14-25(15-7-2)16-8-9-17-26(22(27)28-23(3,4)5)19-21-12-10-20(18-24)11-13-21/h10-13H,6-9,14-19,24H2,1-5H3 |
| InChIKey | MVBQOUDDEUPAOZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|