C21H35N3O4 — CID 142825367
2-[2-[5-aminopentyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl-benzylamino]acetic acid (PubChem CID 142825367) has the molecular formula C21H35N3O4 and a molecular weight of 393.53 g/mol. Its IUPAC name is 2-[2-[5-aminopentyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl-benzylamino]acetic acid.
| Compound Name | 2-[2-[5-aminopentyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl-benzylamino]acetic acid |
|---|---|
| PubChem CID | 142825367 |
| Molecular Formula | C21H35N3O4 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | 2-[2-[5-aminopentyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl-benzylamino]acetic acid |
| SMILES | CC(C)(C)OC(=O)N(CCCCCN)CCN(CC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C21H35N3O4/c1-21(2,3)28-20(27)24(13-9-5-8-12-22)15-14-23(17-19(25)26)16-18-10-6-4-7-11-18/h4,6-7,10-11H,5,8-9,12-17,22H2,1-3H3,(H,25,26) |
| InChIKey | SHJVVHNMJIUXEM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|