C20H33BN2O6 — CID 66581864
[4-[[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]methyl]phenyl]boronic acid (PubChem CID 66581864) has the molecular formula C20H33BN2O6 and a molecular weight of 408.30 g/mol. Its IUPAC name is [4-[[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]methyl]phenyl]boronic acid.
| Compound Name | [4-[[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 66581864 |
| Molecular Formula | C20H33BN2O6 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | [4-[[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]methyl]phenyl]boronic acid |
| SMILES | CC(C)(C)OC(=O)NCCCN(Cc1ccc(B(O)O)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33BN2O6/c1-19(2,3)28-17(24)22-12-7-13-23(18(25)29-20(4,5)6)14-15-8-10-16(11-9-15)21(26)27/h8-11,26-27H,7,12-14H2,1-6H3,(H,22,24) |
| InChIKey | WHLNQBPWAKCTTJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|