C15H23BN4O4 — CID 59243374
[4-[[[(2Z)-2-hydrazinylidene-3-iminopropyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]boronic acid (PubChem CID 59243374) has the molecular formula C15H23BN4O4 and a molecular weight of 334.19 g/mol. Its IUPAC name is [4-[[[(2Z)-2-hydrazinylidene-3-iminopropyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]boronic acid.
| Compound Name | [4-[[[(2Z)-2-hydrazinylidene-3-iminopropyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 59243374 |
| Molecular Formula | C15H23BN4O4 |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [4-[[[(2Z)-2-hydrazinylidene-3-iminopropyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]boronic acid |
| SMILES | [H]/N=C/C(CN(Cc1ccc(B(O)O)cc1)C(=O)OC(C)(C)C)=N\N |
| InChI | InChI=1S/C15H23BN4O4/c1-15(2,3)24-14(21)20(10-13(8-17)19-18)9-11-4-6-12(7-5-11)16(22)23/h4-8,17,22-23H,9-10,18H2,1-3H3/b17-8+,19-13+ |
| InChIKey | YZSYMQKDBKPFGK-JXHOJRNMSA-N |
| XLogP | 0.07 |
| TPSA | 132.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|