C15H23NO6S — CID 90876890
[[4-(hydroxymethyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl methanesulfonate (PubChem CID 90876890) has the molecular formula C15H23NO6S and a molecular weight of 345.42 g/mol. Its IUPAC name is [[4-(hydroxymethyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl methanesulfonate.
| Compound Name | [[4-(hydroxymethyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl methanesulfonate |
|---|---|
| PubChem CID | 90876890 |
| Molecular Formula | C15H23NO6S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | [[4-(hydroxymethyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N(COS(C)(=O)=O)Cc1ccc(CO)cc1 |
| InChI | InChI=1S/C15H23NO6S/c1-15(2,3)22-14(18)16(11-21-23(4,19)20)9-12-5-7-13(10-17)8-6-12/h5-8,17H,9-11H2,1-4H3 |
| InChIKey | QPSFIHQFMWYTPR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|