C20H25NO6S — CID 91361346
[[4-(hydroxymethyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 4-methylbenzenesulfonate (PubChem CID 91361346) has the molecular formula C20H25NO6S and a molecular weight of 407.49 g/mol. Its IUPAC name is [[4-(hydroxymethyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 4-methylbenzenesulfonate.
| Compound Name | [[4-(hydroxymethyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91361346 |
| Molecular Formula | C20H25NO6S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | [[4-(hydroxymethyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON(Cc2ccc(CO)cc2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H25NO6S/c1-15-5-11-18(12-6-15)28(24,25)27-21(19(23)26-20(2,3)4)13-16-7-9-17(14-22)10-8-16/h5-12,22H,13-14H2,1-4H3 |
| InChIKey | OIGQYQYGHLAMHL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|