C27H31NO6S — CID 91308196
[(2-methylpropan-2-yl)oxycarbonyl-[[2-(phenylmethoxymethyl)phenyl]methyl]amino] 4-methylbenzenesulfonate (PubChem CID 91308196) has the molecular formula C27H31NO6S and a molecular weight of 497.61 g/mol. Its IUPAC name is [(2-methylpropan-2-yl)oxycarbonyl-[[2-(phenylmethoxymethyl)phenyl]methyl]amino] 4-methylbenzenesulfonate.
| Compound Name | [(2-methylpropan-2-yl)oxycarbonyl-[[2-(phenylmethoxymethyl)phenyl]methyl]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91308196 |
| Molecular Formula | C27H31NO6S |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | [(2-methylpropan-2-yl)oxycarbonyl-[[2-(phenylmethoxymethyl)phenyl]methyl]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON(Cc2ccccc2COCc2ccccc2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H31NO6S/c1-21-14-16-25(17-15-21)35(30,31)34-28(26(29)33-27(2,3)4)18-23-12-8-9-13-24(23)20-32-19-22-10-6-5-7-11-22/h5-17H,18-20H2,1-4H3 |
| InChIKey | WFFACGZIKGTXKY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|