C13H18ClNO4S — CID 1484576
tert-butyl N-[(4-chlorophenyl)methyl]-N-methylsulfonylcarbamate (PubChem CID 1484576) has the molecular formula C13H18ClNO4S and a molecular weight of 319.81 g/mol. Its IUPAC name is tert-butyl N-[(4-chlorophenyl)methyl]-N-methylsulfonylcarbamate.
| Compound Name | tert-butyl N-[(4-chlorophenyl)methyl]-N-methylsulfonylcarbamate |
|---|---|
| PubChem CID | 1484576 |
| Molecular Formula | C13H18ClNO4S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | tert-butyl N-[(4-chlorophenyl)methyl]-N-methylsulfonylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(Cl)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C13H18ClNO4S/c1-13(2,3)19-12(16)15(20(4,17)18)9-10-5-7-11(14)8-6-10/h5-8H,9H2,1-4H3 |
| InChIKey | ZIYXYULDWOAFMX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |