C21H32ClN5O6S2 — CID 54320023
tert-butyl N-[(4-chlorophenyl)methyl]-N-[4-[1-(dimethylsulfamoyl)imidazol-4-yl]butylsulfamoyl]carbamate (PubChem CID 54320023) has the molecular formula C21H32ClN5O6S2 and a molecular weight of 550.10 g/mol. Its IUPAC name is tert-butyl N-[(4-chlorophenyl)methyl]-N-[4-[1-(dimethylsulfamoyl)imidazol-4-yl]butylsulfamoyl]carbamate.
| Compound Name | tert-butyl N-[(4-chlorophenyl)methyl]-N-[4-[1-(dimethylsulfamoyl)imidazol-4-yl]butylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 54320023 |
| Molecular Formula | C21H32ClN5O6S2 |
| Molecular Weight | 550.10 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | tert-butyl N-[(4-chlorophenyl)methyl]-N-[4-[1-(dimethylsulfamoyl)imidazol-4-yl]butylsulfamoyl]carbamate |
| SMILES | CN(C)S(=O)(=O)n1cnc(CCCCNS(=O)(=O)N(Cc2ccc(Cl)cc2)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H32ClN5O6S2/c1-21(2,3)33-20(28)27(14-17-9-11-18(22)12-10-17)34(29,30)24-13-7-6-8-19-15-26(16-23-19)35(31,32)25(4)5/h9-12,15-16,24H,6-8,13-14H2,1-5H3 |
| InChIKey | SQYWHJCOIXTZBK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 130.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.10 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|