C22H35ClN2O2 — CID 10644376
tert-butyl N-[(4-chlorophenyl)methyl]-N-(6-pyrrolidin-1-ylhexyl)carbamate (PubChem CID 10644376) has the molecular formula C22H35ClN2O2 and a molecular weight of 394.99 g/mol. Its IUPAC name is tert-butyl N-[(4-chlorophenyl)methyl]-N-(6-pyrrolidin-1-ylhexyl)carbamate.
| Compound Name | tert-butyl N-[(4-chlorophenyl)methyl]-N-(6-pyrrolidin-1-ylhexyl)carbamate |
|---|---|
| PubChem CID | 10644376 |
| Molecular Formula | C22H35ClN2O2 |
| Molecular Weight | 394.99 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | tert-butyl N-[(4-chlorophenyl)methyl]-N-(6-pyrrolidin-1-ylhexyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCCCN1CCCC1)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H35ClN2O2/c1-22(2,3)27-21(26)25(18-19-10-12-20(23)13-11-19)17-7-5-4-6-14-24-15-8-9-16-24/h10-13H,4-9,14-18H2,1-3H3 |
| InChIKey | BOMJYRNEUZAQJC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.99 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|