C18H28BrClN2O2 — CID 169043183
tert-butyl N-(3-bromopropyl)-N-[[4-[2-chloroethyl(methyl)amino]phenyl]methyl]carbamate (PubChem CID 169043183) has the molecular formula C18H28BrClN2O2 and a molecular weight of 419.79 g/mol. Its IUPAC name is tert-butyl N-(3-bromopropyl)-N-[[4-[2-chloroethyl(methyl)amino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-(3-bromopropyl)-N-[[4-[2-chloroethyl(methyl)amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 169043183 |
| Molecular Formula | C18H28BrClN2O2 |
| Molecular Weight | 419.79 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | tert-butyl N-(3-bromopropyl)-N-[[4-[2-chloroethyl(methyl)amino]phenyl]methyl]carbamate |
| SMILES | CN(CCCl)c1ccc(CN(CCCBr)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28BrClN2O2/c1-18(2,3)24-17(23)22(12-5-10-19)14-15-6-8-16(9-7-15)21(4)13-11-20/h6-9H,5,10-14H2,1-4H3 |
| InChIKey | HAAMZGOGNFDXRK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.79 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|