C18H30N2O3 — CID 164520133
tert-butyl N-[3-[4-(2-hydroxyethyl)-N-methylanilino]propyl]-N-methylcarbamate (PubChem CID 164520133) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(2-hydroxyethyl)-N-methylanilino]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[4-(2-hydroxyethyl)-N-methylanilino]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 164520133 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | tert-butyl N-[3-[4-(2-hydroxyethyl)-N-methylanilino]propyl]-N-methylcarbamate |
| SMILES | CN(CCCN(C)c1ccc(CCO)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30N2O3/c1-18(2,3)23-17(22)20(5)13-6-12-19(4)16-9-7-15(8-10-16)11-14-21/h7-10,21H,6,11-14H2,1-5H3 |
| InChIKey | SNSXBBRDIUTAPS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|