C16H25NO2S — CID 91391747
tert-butyl N-methyl-N-[4-(2-sulfanylphenyl)butyl]carbamate (PubChem CID 91391747) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[4-(2-sulfanylphenyl)butyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[4-(2-sulfanylphenyl)butyl]carbamate |
|---|---|
| PubChem CID | 91391747 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | tert-butyl N-methyl-N-[4-(2-sulfanylphenyl)butyl]carbamate |
| SMILES | CN(CCCCc1ccccc1S)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25NO2S/c1-16(2,3)19-15(18)17(4)12-8-7-10-13-9-5-6-11-14(13)20/h5-6,9,11,20H,7-8,10,12H2,1-4H3 |
| InChIKey | AVHYWPVUUNHCPI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|