C18H30N2O3 — CID 104924777
tert-butyl N-[3-[1-(2-hydroxyphenyl)propylamino]propyl]-N-methylcarbamate (PubChem CID 104924777) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is tert-butyl N-[3-[1-(2-hydroxyphenyl)propylamino]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[1-(2-hydroxyphenyl)propylamino]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 104924777 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | tert-butyl N-[3-[1-(2-hydroxyphenyl)propylamino]propyl]-N-methylcarbamate |
| SMILES | CCC(NCCCN(C)C(=O)OC(C)(C)C)c1ccccc1O |
| InChI | InChI=1S/C18H30N2O3/c1-6-15(14-10-7-8-11-16(14)21)19-12-9-13-20(5)17(22)23-18(2,3)4/h7-8,10-11,15,19,21H,6,9,12-13H2,1-5H3 |
| InChIKey | AMYCZGZIBDDRHC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|