C15H26N2O3S — CID 61013782
N-ethyl-N-[3-[1-(2-hydroxyphenyl)propylamino]propyl]methanesulfonamide (PubChem CID 61013782) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is N-ethyl-N-[3-[1-(2-hydroxyphenyl)propylamino]propyl]methanesulfonamide.
| Compound Name | N-ethyl-N-[3-[1-(2-hydroxyphenyl)propylamino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 61013782 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N-ethyl-N-[3-[1-(2-hydroxyphenyl)propylamino]propyl]methanesulfonamide |
| SMILES | CCC(NCCCN(CC)S(C)(=O)=O)c1ccccc1O |
| InChI | InChI=1S/C15H26N2O3S/c1-4-14(13-9-6-7-10-15(13)18)16-11-8-12-17(5-2)21(3,19)20/h6-7,9-10,14,16,18H,4-5,8,11-12H2,1-3H3 |
| InChIKey | BLJFLHZBYLYXFJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|