C12H19NO3S — CID 54931599
2-[1-(2-methylsulfonylethylamino)propyl]phenol (PubChem CID 54931599) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 2-[1-(2-methylsulfonylethylamino)propyl]phenol.
| Compound Name | 2-[1-(2-methylsulfonylethylamino)propyl]phenol |
|---|---|
| PubChem CID | 54931599 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-[1-(2-methylsulfonylethylamino)propyl]phenol |
| SMILES | CCC(NCCS(C)(=O)=O)c1ccccc1O |
| InChI | InChI=1S/C12H19NO3S/c1-3-11(13-8-9-17(2,15)16)10-6-4-5-7-12(10)14/h4-7,11,13-14H,3,8-9H2,1-2H3 |
| InChIKey | NUWYVWYBPPOXDL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|