C14H22F2N2O2S — CID 61015400
N-[3-[1-(2,6-difluorophenyl)ethylamino]propyl]-N-ethylmethanesulfonamide (PubChem CID 61015400) has the molecular formula C14H22F2N2O2S and a molecular weight of 320.40 g/mol. Its IUPAC name is N-[3-[1-(2,6-difluorophenyl)ethylamino]propyl]-N-ethylmethanesulfonamide.
| Compound Name | N-[3-[1-(2,6-difluorophenyl)ethylamino]propyl]-N-ethylmethanesulfonamide |
|---|---|
| PubChem CID | 61015400 |
| Molecular Formula | C14H22F2N2O2S |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-[3-[1-(2,6-difluorophenyl)ethylamino]propyl]-N-ethylmethanesulfonamide |
| SMILES | CCN(CCCNC(C)c1c(F)cccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C14H22F2N2O2S/c1-4-18(21(3,19)20)10-6-9-17-11(2)14-12(15)7-5-8-13(14)16/h5,7-8,11,17H,4,6,9-10H2,1-3H3 |
| InChIKey | VBFRXZCRNUOPFL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|