C12H18FN3O3S — CID 115497535
N-[3-[ethyl(methylsulfonyl)amino]propyl]-6-fluoropyridine-2-carboxamide (PubChem CID 115497535) has the molecular formula C12H18FN3O3S and a molecular weight of 303.36 g/mol. Its IUPAC name is N-[3-[ethyl(methylsulfonyl)amino]propyl]-6-fluoropyridine-2-carboxamide.
| Compound Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-6-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 115497535 |
| Molecular Formula | C12H18FN3O3S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-6-fluoropyridine-2-carboxamide |
| SMILES | CCN(CCCNC(=O)c1cccc(F)n1)S(C)(=O)=O |
| InChI | InChI=1S/C12H18FN3O3S/c1-3-16(20(2,18)19)9-5-8-14-12(17)10-6-4-7-11(13)15-10/h4,6-7H,3,5,8-9H2,1-2H3,(H,14,17) |
| InChIKey | FNLWYAIXPROJLA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|