C13H17FN2O3 — CID 113323237
7-[(6-fluoropyridine-2-carbonyl)amino]heptanoic acid (PubChem CID 113323237) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is 7-[(6-fluoropyridine-2-carbonyl)amino]heptanoic acid.
| Compound Name | 7-[(6-fluoropyridine-2-carbonyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 113323237 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 7-[(6-fluoropyridine-2-carbonyl)amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)c1cccc(F)n1 |
| InChI | InChI=1S/C13H17FN2O3/c14-11-7-5-6-10(16-11)13(19)15-9-4-2-1-3-8-12(17)18/h5-7H,1-4,8-9H2,(H,15,19)(H,17,18) |
| InChIKey | YFAFBBZQRKMCMD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|