C14H19FN2O3 — CID 115496471
6-[(6-fluoropyridine-2-carbonyl)amino]-4,4-dimethylhexanoic acid (PubChem CID 115496471) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is 6-[(6-fluoropyridine-2-carbonyl)amino]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[(6-fluoropyridine-2-carbonyl)amino]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 115496471 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 6-[(6-fluoropyridine-2-carbonyl)amino]-4,4-dimethylhexanoic acid |
| SMILES | CC(C)(CCNC(=O)c1cccc(F)n1)CCC(=O)O |
| InChI | InChI=1S/C14H19FN2O3/c1-14(2,7-6-12(18)19)8-9-16-13(20)10-4-3-5-11(15)17-10/h3-5H,6-9H2,1-2H3,(H,16,20)(H,18,19) |
| InChIKey | FUQBMAMDRPQLQM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|