C15H19ClFNO3 — CID 81266022
6-[(3-chloro-2-fluorobenzoyl)amino]-4,4-dimethylhexanoic acid (PubChem CID 81266022) has the molecular formula C15H19ClFNO3 and a molecular weight of 315.77 g/mol. Its IUPAC name is 6-[(3-chloro-2-fluorobenzoyl)amino]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[(3-chloro-2-fluorobenzoyl)amino]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 81266022 |
| Molecular Formula | C15H19ClFNO3 |
| Molecular Weight | 315.77 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 6-[(3-chloro-2-fluorobenzoyl)amino]-4,4-dimethylhexanoic acid |
| SMILES | CC(C)(CCNC(=O)c1cccc(Cl)c1F)CCC(=O)O |
| InChI | InChI=1S/C15H19ClFNO3/c1-15(2,7-6-12(19)20)8-9-18-14(21)10-4-3-5-11(16)13(10)17/h3-5H,6-9H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | TUBCAWCYHNLRBR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.77 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |