C14H19ClN2O3 — CID 65283971
6-[(4-chloropyridine-2-carbonyl)amino]-4,4-dimethylhexanoic acid (PubChem CID 65283971) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is 6-[(4-chloropyridine-2-carbonyl)amino]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[(4-chloropyridine-2-carbonyl)amino]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 65283971 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 6-[(4-chloropyridine-2-carbonyl)amino]-4,4-dimethylhexanoic acid |
| SMILES | CC(C)(CCNC(=O)c1cc(Cl)ccn1)CCC(=O)O |
| InChI | InChI=1S/C14H19ClN2O3/c1-14(2,5-3-12(18)19)6-8-17-13(20)11-9-10(15)4-7-16-11/h4,7,9H,3,5-6,8H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | UQIHAZAYCNBNMS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |