C12H17ClN2O — CID 103461085
4-chloro-N-(2,2-dimethylbutyl)pyridine-2-carboxamide (PubChem CID 103461085) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 4-chloro-N-(2,2-dimethylbutyl)pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-(2,2-dimethylbutyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 103461085 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-chloro-N-(2,2-dimethylbutyl)pyridine-2-carboxamide |
| SMILES | CCC(C)(C)CNC(=O)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C12H17ClN2O/c1-4-12(2,3)8-15-11(16)10-7-9(13)5-6-14-10/h5-7H,4,8H2,1-3H3,(H,15,16) |
| InChIKey | XGSATTFWSCUCSL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |