C13H19ClN2O2 — CID 103899472
4-chloro-N-(5-hydroxy-2,2-dimethylpentyl)pyridine-2-carboxamide (PubChem CID 103899472) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 4-chloro-N-(5-hydroxy-2,2-dimethylpentyl)pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-(5-hydroxy-2,2-dimethylpentyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 103899472 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 4-chloro-N-(5-hydroxy-2,2-dimethylpentyl)pyridine-2-carboxamide |
| SMILES | CC(C)(CCCO)CNC(=O)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C13H19ClN2O2/c1-13(2,5-3-7-17)9-16-12(18)11-8-10(14)4-6-15-11/h4,6,8,17H,3,5,7,9H2,1-2H3,(H,16,18) |
| InChIKey | CSRKTMNOGLBCKU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |