C14H13FN2O3 — CID 110464541
4-[(8-fluoroquinoline-2-carbonyl)amino]butanoic acid (PubChem CID 110464541) has the molecular formula C14H13FN2O3 and a molecular weight of 276.27 g/mol. Its IUPAC name is 4-[(8-fluoroquinoline-2-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(8-fluoroquinoline-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 110464541 |
| Molecular Formula | C14H13FN2O3 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-[(8-fluoroquinoline-2-carbonyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)c1ccc2cccc(F)c2n1 |
| InChI | InChI=1S/C14H13FN2O3/c15-10-4-1-3-9-6-7-11(17-13(9)10)14(20)16-8-2-5-12(18)19/h1,3-4,6-7H,2,5,8H2,(H,16,20)(H,18,19) |
| InChIKey | UGEBHXGRGKNORJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|