C12H14FN3O2 — CID 122058454
4-[(4-fluoro-1-methylbenzimidazol-2-yl)amino]butanoic acid (PubChem CID 122058454) has the molecular formula C12H14FN3O2 and a molecular weight of 251.26 g/mol. Its IUPAC name is 4-[(4-fluoro-1-methylbenzimidazol-2-yl)amino]butanoic acid.
| Compound Name | 4-[(4-fluoro-1-methylbenzimidazol-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 122058454 |
| Molecular Formula | C12H14FN3O2 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 4-[(4-fluoro-1-methylbenzimidazol-2-yl)amino]butanoic acid |
| SMILES | Cn1c(NCCCC(=O)O)nc2c(F)cccc21 |
| InChI | InChI=1S/C12H14FN3O2/c1-16-9-5-2-4-8(13)11(9)15-12(16)14-7-3-6-10(17)18/h2,4-5H,3,6-7H2,1H3,(H,14,15)(H,17,18) |
| InChIKey | UJELBFKLNIDTIY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|