C11H17ClN4O3S — CID 61053648
6-chloro-N-[3-[ethyl(methylsulfonyl)amino]propyl]pyridazine-3-carboxamide (PubChem CID 61053648) has the molecular formula C11H17ClN4O3S and a molecular weight of 320.80 g/mol. Its IUPAC name is 6-chloro-N-[3-[ethyl(methylsulfonyl)amino]propyl]pyridazine-3-carboxamide.
| Compound Name | 6-chloro-N-[3-[ethyl(methylsulfonyl)amino]propyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 61053648 |
| Molecular Formula | C11H17ClN4O3S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 6-chloro-N-[3-[ethyl(methylsulfonyl)amino]propyl]pyridazine-3-carboxamide |
| SMILES | CCN(CCCNC(=O)c1ccc(Cl)nn1)S(C)(=O)=O |
| InChI | InChI=1S/C11H17ClN4O3S/c1-3-16(20(2,18)19)8-4-7-13-11(17)9-5-6-10(12)15-14-9/h5-6H,3-4,7-8H2,1-2H3,(H,13,17) |
| InChIKey | VVWFFMRNCFUSSU-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|