C14H23N3O3S — CID 61289684
5-amino-N-[3-[ethyl(methylsulfonyl)amino]propyl]-2-methylbenzamide (PubChem CID 61289684) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 5-amino-N-[3-[ethyl(methylsulfonyl)amino]propyl]-2-methylbenzamide.
| Compound Name | 5-amino-N-[3-[ethyl(methylsulfonyl)amino]propyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 61289684 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 5-amino-N-[3-[ethyl(methylsulfonyl)amino]propyl]-2-methylbenzamide |
| SMILES | CCN(CCCNC(=O)c1cc(N)ccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C14H23N3O3S/c1-4-17(21(3,19)20)9-5-8-16-14(18)13-10-12(15)7-6-11(13)2/h6-7,10H,4-5,8-9,15H2,1-3H3,(H,16,18) |
| InChIKey | CQKSZEDVFBKDFS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|