C9H13ClN4O3S — CID 114175119
6-chloro-N-[2-(dimethylsulfamoyl)ethyl]pyridazine-3-carboxamide (PubChem CID 114175119) has the molecular formula C9H13ClN4O3S and a molecular weight of 292.75 g/mol. Its IUPAC name is 6-chloro-N-[2-(dimethylsulfamoyl)ethyl]pyridazine-3-carboxamide.
| Compound Name | 6-chloro-N-[2-(dimethylsulfamoyl)ethyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 114175119 |
| Molecular Formula | C9H13ClN4O3S |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 6-chloro-N-[2-(dimethylsulfamoyl)ethyl]pyridazine-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C9H13ClN4O3S/c1-14(2)18(16,17)6-5-11-9(15)7-3-4-8(10)13-12-7/h3-4H,5-6H2,1-2H3,(H,11,15) |
| InChIKey | IQDXIIAVHKXSLC-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |