C9H18N6O3S — CID 106337535
1-(2-aminoethyl)-N-[2-(dimethylsulfamoyl)ethyl]triazole-4-carboxamide (PubChem CID 106337535) has the molecular formula C9H18N6O3S and a molecular weight of 290.35 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-[2-(dimethylsulfamoyl)ethyl]triazole-4-carboxamide.
| Compound Name | 1-(2-aminoethyl)-N-[2-(dimethylsulfamoyl)ethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 106337535 |
| Molecular Formula | C9H18N6O3S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-(2-aminoethyl)-N-[2-(dimethylsulfamoyl)ethyl]triazole-4-carboxamide |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)c1cn(CCN)nn1 |
| InChI | InChI=1S/C9H18N6O3S/c1-14(2)19(17,18)6-4-11-9(16)8-7-15(5-3-10)13-12-8/h7H,3-6,10H2,1-2H3,(H,11,16) |
| InChIKey | ZWXXYBPKFPVUDN-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |