C9H13N5O — CID 114417029
1-(2-aminoethyl)-N-but-3-yn-2-yltriazole-4-carboxamide (PubChem CID 114417029) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-but-3-yn-2-yltriazole-4-carboxamide.
| Compound Name | 1-(2-aminoethyl)-N-but-3-yn-2-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 114417029 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 1-(2-aminoethyl)-N-but-3-yn-2-yltriazole-4-carboxamide |
| SMILES | C#CC(C)NC(=O)c1cn(CCN)nn1 |
| InChI | InChI=1S/C9H13N5O/c1-3-7(2)11-9(15)8-6-14(5-4-10)13-12-8/h1,6-7H,4-5,10H2,2H3,(H,11,15) |
| InChIKey | DVGGSRAXKMLKEW-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|