C12H22N6O — CID 105417102
1-(2-aminoethyl)-N-[[1-(dimethylamino)cyclobutyl]methyl]triazole-4-carboxamide (PubChem CID 105417102) has the molecular formula C12H22N6O and a molecular weight of 266.35 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-[[1-(dimethylamino)cyclobutyl]methyl]triazole-4-carboxamide.
| Compound Name | 1-(2-aminoethyl)-N-[[1-(dimethylamino)cyclobutyl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 105417102 |
| Molecular Formula | C12H22N6O |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 1-(2-aminoethyl)-N-[[1-(dimethylamino)cyclobutyl]methyl]triazole-4-carboxamide |
| SMILES | CN(C)C1(CNC(=O)c2cn(CCN)nn2)CCC1 |
| InChI | InChI=1S/C12H22N6O/c1-17(2)12(4-3-5-12)9-14-11(19)10-8-18(7-6-13)16-15-10/h8H,3-7,9,13H2,1-2H3,(H,14,19) |
| InChIKey | DKMFTXZMOCFBTJ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |