C11H15N3O — CID 104919693
N-but-3-yn-2-yl-3-ethyl-1-methylpyrazole-4-carboxamide (PubChem CID 104919693) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is N-but-3-yn-2-yl-3-ethyl-1-methylpyrazole-4-carboxamide.
| Compound Name | N-but-3-yn-2-yl-3-ethyl-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 104919693 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | N-but-3-yn-2-yl-3-ethyl-1-methylpyrazole-4-carboxamide |
| SMILES | C#CC(C)NC(=O)c1cn(C)nc1CC |
| InChI | InChI=1S/C11H15N3O/c1-5-8(3)12-11(15)9-7-14(4)13-10(9)6-2/h1,7-8H,6H2,2-4H3,(H,12,15) |
| InChIKey | PHSMSNKYJZUITR-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|