C11H17N3O4 — CID 104964317
methyl 2-[(3-ethyl-1-methylpyrazole-4-carbonyl)amino]-3-hydroxypropanoate (PubChem CID 104964317) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is methyl 2-[(3-ethyl-1-methylpyrazole-4-carbonyl)amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[(3-ethyl-1-methylpyrazole-4-carbonyl)amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 104964317 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | methyl 2-[(3-ethyl-1-methylpyrazole-4-carbonyl)amino]-3-hydroxypropanoate |
| SMILES | CCc1nn(C)cc1C(=O)NC(CO)C(=O)OC |
| InChI | InChI=1S/C11H17N3O4/c1-4-8-7(5-14(2)13-8)10(16)12-9(6-15)11(17)18-3/h5,9,15H,4,6H2,1-3H3,(H,12,16) |
| InChIKey | OKYYSLKFWDWOBA-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |