C17H25N3O4 — CID 122153154
tert-butyl N-[2-[2-(acetamidocarbamoyl)phenyl]ethyl]-N-methylcarbamate (PubChem CID 122153154) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(acetamidocarbamoyl)phenyl]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[2-(acetamidocarbamoyl)phenyl]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 122153154 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | tert-butyl N-[2-[2-(acetamidocarbamoyl)phenyl]ethyl]-N-methylcarbamate |
| SMILES | CC(=O)NNC(=O)c1ccccc1CCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25N3O4/c1-12(21)18-19-15(22)14-9-7-6-8-13(14)10-11-20(5)16(23)24-17(2,3)4/h6-9H,10-11H2,1-5H3,(H,18,21)(H,19,22) |
| InChIKey | IYJUIFFEQUUEBE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|