C25H27NO4 — CID 68879355
[4-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] naphthalene-1-carboxylate (PubChem CID 68879355) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is [4-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [4-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 68879355 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | [4-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] naphthalene-1-carboxylate |
| SMILES | CN(CCc1ccc(OC(=O)c2cccc3ccccc23)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H27NO4/c1-25(2,3)30-24(28)26(4)17-16-18-12-14-20(15-13-18)29-23(27)22-11-7-9-19-8-5-6-10-21(19)22/h5-15H,16-17H2,1-4H3 |
| InChIKey | WZLFIPQXYBIACU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|