C21H27NO3 — CID 67952576
tert-butyl N-methyl-N-[2-[4-(3-methylphenoxy)phenyl]ethyl]carbamate (PubChem CID 67952576) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[4-(3-methylphenoxy)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-[4-(3-methylphenoxy)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 67952576 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[4-(3-methylphenoxy)phenyl]ethyl]carbamate |
| SMILES | Cc1cccc(Oc2ccc(CCN(C)C(=O)OC(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C21H27NO3/c1-16-7-6-8-19(15-16)24-18-11-9-17(10-12-18)13-14-22(5)20(23)25-21(2,3)4/h6-12,15H,13-14H2,1-5H3 |
| InChIKey | GLSYDJHQVTYTQM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |