C22H26F3NO3 — CID 11718487
tert-butyl N-methyl-N-[2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]ethyl]carbamate (PubChem CID 11718487) has the molecular formula C22H26F3NO3 and a molecular weight of 409.45 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 11718487 |
| Molecular Formula | C22H26F3NO3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]ethyl]carbamate |
| SMILES | CN(CCc1ccc(OCc2ccc(C(F)(F)F)cc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H26F3NO3/c1-21(2,3)29-20(27)26(4)14-13-16-7-11-19(12-8-16)28-15-17-5-9-18(10-6-17)22(23,24)25/h5-12H,13-15H2,1-4H3 |
| InChIKey | DRBZYQDSHHAUJP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |