C19H20F3NO4S — CID 66578110
2-methylsulfonyl-4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]butanamide (PubChem CID 66578110) has the molecular formula C19H20F3NO4S and a molecular weight of 415.43 g/mol. Its IUPAC name is 2-methylsulfonyl-4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]butanamide.
| Compound Name | 2-methylsulfonyl-4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]butanamide |
|---|---|
| PubChem CID | 66578110 |
| Molecular Formula | C19H20F3NO4S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-methylsulfonyl-4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]butanamide |
| SMILES | CS(=O)(=O)C(CCc1ccc(OCc2ccc(C(F)(F)F)cc2)cc1)C(N)=O |
| InChI | InChI=1S/C19H20F3NO4S/c1-28(25,26)17(18(23)24)11-6-13-4-9-16(10-5-13)27-12-14-2-7-15(8-3-14)19(20,21)22/h2-5,7-10,17H,6,11-12H2,1H3,(H2,23,24) |
| InChIKey | SBXQTMQMIMCRFK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |