C16H13F3O6S — CID 13340075
1-hydroxy-2-oxo-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]ethanesulfonic acid (PubChem CID 13340075) has the molecular formula C16H13F3O6S and a molecular weight of 390.34 g/mol. Its IUPAC name is 1-hydroxy-2-oxo-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]ethanesulfonic acid.
| Compound Name | 1-hydroxy-2-oxo-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 13340075 |
| Molecular Formula | C16H13F3O6S |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 1-hydroxy-2-oxo-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]ethanesulfonic acid |
| SMILES | O=C(c1ccc(OCc2ccc(C(F)(F)F)cc2)cc1)C(O)S(=O)(=O)O |
| InChI | InChI=1S/C16H13F3O6S/c17-16(18,19)12-5-1-10(2-6-12)9-25-13-7-3-11(4-8-13)14(20)15(21)26(22,23)24/h1-8,15,21H,9H2,(H,22,23,24) |
| InChIKey | ATLFSQTZRYWYAZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|