C16H16O7S — CID 13340087
1-hydroxy-2-[4-[(4-methoxyphenyl)methoxy]phenyl]-2-oxoethanesulfonic acid (PubChem CID 13340087) has the molecular formula C16H16O7S and a molecular weight of 352.36 g/mol. Its IUPAC name is 1-hydroxy-2-[4-[(4-methoxyphenyl)methoxy]phenyl]-2-oxoethanesulfonic acid.
| Compound Name | 1-hydroxy-2-[4-[(4-methoxyphenyl)methoxy]phenyl]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 13340087 |
| Molecular Formula | C16H16O7S |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 1-hydroxy-2-[4-[(4-methoxyphenyl)methoxy]phenyl]-2-oxoethanesulfonic acid |
| SMILES | COc1ccc(COc2ccc(C(=O)C(O)S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H16O7S/c1-22-13-6-2-11(3-7-13)10-23-14-8-4-12(5-9-14)15(17)16(18)24(19,20)21/h2-9,16,18H,10H2,1H3,(H,19,20,21) |
| InChIKey | HLXYPLIDKFUMDE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|