C16H16O6S — CID 13340067
1-hydroxy-2-oxo-2-[4-(2-phenylethoxy)phenyl]ethanesulfonic acid (PubChem CID 13340067) has the molecular formula C16H16O6S and a molecular weight of 336.36 g/mol. Its IUPAC name is 1-hydroxy-2-oxo-2-[4-(2-phenylethoxy)phenyl]ethanesulfonic acid.
| Compound Name | 1-hydroxy-2-oxo-2-[4-(2-phenylethoxy)phenyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 13340067 |
| Molecular Formula | C16H16O6S |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 1-hydroxy-2-oxo-2-[4-(2-phenylethoxy)phenyl]ethanesulfonic acid |
| SMILES | O=C(c1ccc(OCCc2ccccc2)cc1)C(O)S(=O)(=O)O |
| InChI | InChI=1S/C16H16O6S/c17-15(16(18)23(19,20)21)13-6-8-14(9-7-13)22-11-10-12-4-2-1-3-5-12/h1-9,16,18H,10-11H2,(H,19,20,21) |
| InChIKey | DQNWRPGWUDTNNX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|