C22H19ClN2O3 — CID 4956611
N'-(4-chlorobenzoyl)-4-(2-phenylethoxy)benzohydrazide (PubChem CID 4956611) has the molecular formula C22H19ClN2O3 and a molecular weight of 394.86 g/mol. Its IUPAC name is N'-(4-chlorobenzoyl)-4-(2-phenylethoxy)benzohydrazide.
| Compound Name | N'-(4-chlorobenzoyl)-4-(2-phenylethoxy)benzohydrazide |
|---|---|
| PubChem CID | 4956611 |
| Molecular Formula | C22H19ClN2O3 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N'-(4-chlorobenzoyl)-4-(2-phenylethoxy)benzohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(OCCc2ccccc2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19ClN2O3/c23-19-10-6-17(7-11-19)21(26)24-25-22(27)18-8-12-20(13-9-18)28-15-14-16-4-2-1-3-5-16/h1-13H,14-15H2,(H,24,26)(H,25,27) |
| InChIKey | SQUCAZVFPULHDL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|