C24H24N2O4 — CID 4952848
4-(2-phenoxyethoxy)-N'-(3-phenylpropanoyl)benzohydrazide (PubChem CID 4952848) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-(2-phenoxyethoxy)-N'-(3-phenylpropanoyl)benzohydrazide.
| Compound Name | 4-(2-phenoxyethoxy)-N'-(3-phenylpropanoyl)benzohydrazide |
|---|---|
| PubChem CID | 4952848 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 4-(2-phenoxyethoxy)-N'-(3-phenylpropanoyl)benzohydrazide |
| SMILES | O=C(CCc1ccccc1)NNC(=O)c1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N2O4/c27-23(16-11-19-7-3-1-4-8-19)25-26-24(28)20-12-14-22(15-13-20)30-18-17-29-21-9-5-2-6-10-21/h1-10,12-15H,11,16-18H2,(H,25,27)(H,26,28) |
| InChIKey | HYIKYTBDWQZHJD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|