C18H20N2O3 — CID 4938615
N'-(2-phenylacetyl)-4-propoxybenzohydrazide (PubChem CID 4938615) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is N'-(2-phenylacetyl)-4-propoxybenzohydrazide.
| Compound Name | N'-(2-phenylacetyl)-4-propoxybenzohydrazide |
|---|---|
| PubChem CID | 4938615 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N'-(2-phenylacetyl)-4-propoxybenzohydrazide |
| SMILES | CCCOc1ccc(C(=O)NNC(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H20N2O3/c1-2-12-23-16-10-8-15(9-11-16)18(22)20-19-17(21)13-14-6-4-3-5-7-14/h3-11H,2,12-13H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | UEYDMWQWXBHDNK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|