C22H28N2O3 — CID 26163669
4-hexoxy-N'-[2-(2-methylphenyl)acetyl]benzohydrazide (PubChem CID 26163669) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 4-hexoxy-N'-[2-(2-methylphenyl)acetyl]benzohydrazide.
| Compound Name | 4-hexoxy-N'-[2-(2-methylphenyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 26163669 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 4-hexoxy-N'-[2-(2-methylphenyl)acetyl]benzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)Cc2ccccc2C)cc1 |
| InChI | InChI=1S/C22H28N2O3/c1-3-4-5-8-15-27-20-13-11-18(12-14-20)22(26)24-23-21(25)16-19-10-7-6-9-17(19)2/h6-7,9-14H,3-5,8,15-16H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | ZUDOAJGEWWXAAI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|