About [4-(2-phenylethoxy)phenyl]methyl carbamate
[4-(2-phenylethoxy)phenyl]methyl carbamate (PubChem CID 141040425) has the molecular formula C16H17NO3
and a molecular weight of 271.32 g/mol. Its IUPAC name is [4-(2-phenylethoxy)phenyl]methyl carbamate.
Molecular Properties
| Compound Name | [4-(2-phenylethoxy)phenyl]methyl carbamate |
| PubChem CID | 141040425 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | [4-(2-phenylethoxy)phenyl]methyl carbamate |
| SMILES | NC(=O)OCc1ccc(OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H17NO3/c17-16(18)20-12-14-6-8-15(9-7-14)19-11-10-13-4-2-1-3-5-13/h1-9H,10-12H2,(H2,17,18) |
| InChIKey | WLZTXSUAMWGKKU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(2-phenylethoxy)phenyl]methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-phenylethoxy)phenyl]methyl carbamate?
The IUPAC name of [4-(2-phenylethoxy)phenyl]methyl carbamate (CID 141040425) is [4-(2-phenylethoxy)phenyl]methyl carbamate.
What is the SMILES notation for [4-(2-phenylethoxy)phenyl]methyl carbamate?
The canonical SMILES for [4-(2-phenylethoxy)phenyl]methyl carbamate is NC(=O)OCc1ccc(OCCc2ccccc2)cc1.
What is the InChIKey of [4-(2-phenylethoxy)phenyl]methyl carbamate?
The InChIKey is WLZTXSUAMWGKKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3/c17-16(18)20-12-14-6-8-15(9-7-14)19-11-10-13-4-2-1-3-5-13/h1-9H,10-12H2,(H2,17,18).
What are the key properties of [4-(2-phenylethoxy)phenyl]methyl carbamate?
[4-(2-phenylethoxy)phenyl]methyl carbamate has a molecular weight of 271.32 g/mol, XLogP of 2.90, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-phenylethoxy)phenyl]methyl carbamate is sourced from PubChem (CID 141040425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).